Products 1627693-45-1
CAS 1627693-45-1 is the registry number for Methyl 2-Fluoro-4-(4-oxocyclohexyl)benzoate, >95%, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g.
Methyl 2-fluoro-4-(4-oxocyclohexyl)benzoate (CAS 1627693-45-1) is a chemical compound with the molecular formula C14H15FO3 and a molecular weight of 250.26 g/mol. IUPAC name: methyl 2-fluoro-4-(4-oxocyclohexyl)benzoate. InChIKey: IMAQHJIIAZBISR-UHFFFAOYSA-N.
| Molecular formula | C14H15FO3 |
|---|---|
| Molecular weight | 250.26 g/mol |
| IUPAC name | methyl 2-fluoro-4-(4-oxocyclohexyl)benzoate |
| InChIKey | IMAQHJIIAZBISR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C2CCC(=O)CC2)F |
Computed by PubChem (NCBI)