CAS 1627754-75-9 is the registry number for TERT-BUTYL (5-FLUORO-2-NITROPHENYL)(METHYL)CARBAMATE, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl N-(5-fluoro-2-nitrophenyl)-N-methylcarbamate (CAS 1627754-75-9) is a chemical compound with the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. IUPAC name: tert-butyl N-(5-fluoro-2-nitrophenyl)-N-methylcarbamate. InChIKey: YKEKREVTAHXHFF-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O4 |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | tert-butyl N-(5-fluoro-2-nitrophenyl)-N-methylcarbamate |
| InChIKey | YKEKREVTAHXHFF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)C1=C(C=CC(=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)