CAS 885280-67-1 appears in our catalog under these names: (4-Fluoro-3-nitro-benzyl)-carbamic acid tert-butyl ester, 95%, tert-Butyl 4-fluoro-3-nitrobenzylcarbamate, 95+%, (4-Fluoro-3-nitro-benzyl)-carbamic acid tert-butyl ester, 95%, 95%, TERT-BUTYL 4-FLUORO-3-NITROBENZYLCARBAMATE, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
Tert-butyl N-[(4-fluoro-3-nitrophenyl)methyl]carbamate (CAS 885280-67-1) is a chemical compound with the molecular formula C12H15FN2O4 and a molecular weight of 270.26 g/mol. IUPAC name: tert-butyl N-[(4-fluoro-3-nitrophenyl)methyl]carbamate. InChIKey: WRMNFPXJSFBABQ-UHFFFAOYSA-N.
| Molecular formula | C12H15FN2O4 |
|---|---|
| Molecular weight | 270.26 g/mol |
| IUPAC name | tert-butyl N-[(4-fluoro-3-nitrophenyl)methyl]carbamate |
| InChIKey | WRMNFPXJSFBABQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)