Products 162791-23-3
CAS 162791-23-3 is the registry number for 11-Azaartemisinin. Offered by: TRC. Available pack sizes: 10mg, 1mg.
(1S,9R)-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one (CAS 162791-23-3) is a chemical compound with the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. IUPAC name: (1S,9R)-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one. InChIKey: LSHOKYZGSIIBMK-FJAJAOGTSA-N.
| Molecular formula | C15H23NO4 |
|---|---|
| Molecular weight | 281.35 g/mol |
| IUPAC name | (1S,9R)-1,5,9-trimethyl-14,15,16-trioxa-11-azatetracyclo[10.3.1.04,13.08,13]hexadecan-10-one |
| InChIKey | LSHOKYZGSIIBMK-FJAJAOGTSA-N |
| SMILES | C[C@@H]1C2CCC(C3C24C(NC1=O)O[C@](CC3)(OO4)C)C |
Computed by PubChem (NCBI)