CAS 1628015-18-8 is the registry number for 4'-Methanesulfonyl-2-trifluoromethyl-biphenyl-4-ylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-methylsulfonylphenyl)-3-(trifluoromethyl)aniline (CAS 1628015-18-8) is a chemical compound with the molecular formula C14H12F3NO2S and a molecular weight of 315.31 g/mol. IUPAC name: 4-(4-methylsulfonylphenyl)-3-(trifluoromethyl)aniline. InChIKey: CUSDIJRQJUNPIC-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2S |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | 4-(4-methylsulfonylphenyl)-3-(trifluoromethyl)aniline |
| InChIKey | CUSDIJRQJUNPIC-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)N)C(F)(F)F |
Computed by PubChem (NCBI)