CAS 329941-42-6 is the registry number for 4-methyl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
4-methyl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide (CAS 329941-42-6) is a chemical compound with the molecular formula C14H12F3NO2S and a molecular weight of 315.31 g/mol. IUPAC name: 4-methyl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide. InChIKey: OKKLBZGYMORYHE-UHFFFAOYSA-N.
| Molecular formula | C14H12F3NO2S |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | 4-methyl-N-[2-(trifluoromethyl)phenyl]benzenesulfonamide |
| InChIKey | OKKLBZGYMORYHE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)NC2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)