CAS 1628042-58-9 is the registry number for TERT-BUTYL 4-CHLORO-2-METHYL-5,8-DIHYDROPYRIDO(3,4-D)PYRIMIDINE-7(6H)-CARBOXYLATE, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate (CAS 1628042-58-9) is a chemical compound with the molecular formula C13H18ClN3O2 and a molecular weight of 283.75 g/mol. IUPAC name: tert-butyl 4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate. InChIKey: ZGZICFOPPBDXQE-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O2 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | tert-butyl 4-chloro-2-methyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidine-7-carboxylate |
| InChIKey | ZGZICFOPPBDXQE-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(CCN(C2)C(=O)OC(C)(C)C)C(=N1)Cl |
Computed by PubChem (NCBI)