CAS 414881-87-1 is the registry number for Piperazine, 1-[(2-chloro-5-nitrophenyl)methyl]-4-ethyl-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
1-[(2-chloro-5-nitrophenyl)methyl]-4-ethylpiperazine (CAS 414881-87-1) is a chemical compound with the molecular formula C13H18ClN3O2 and a molecular weight of 283.75 g/mol. IUPAC name: 1-[(2-chloro-5-nitrophenyl)methyl]-4-ethylpiperazine. InChIKey: UYIORSOVURCUCU-UHFFFAOYSA-N.
| Molecular formula | C13H18ClN3O2 |
|---|---|
| Molecular weight | 283.75 g/mol |
| IUPAC name | 1-[(2-chloro-5-nitrophenyl)methyl]-4-ethylpiperazine |
| InChIKey | UYIORSOVURCUCU-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=C(C=CC(=C2)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)