CAS 1628110-84-8 appears in our catalog under these names: Penconazole-d7, >95% (HPLC), (±)-Penconazole-d7 (pentyl-3,3,4,4,5,5,5-d7), 98 atom % D, min 98% Chemical Purity, Penconazole–d7, Penconazole-d7, 99.17%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 1mg, 2,5mg, 5mg, 0,05g, 0,01g, 1 mg.
1-[3,3,4,4,5,5,5-heptadeuterio-2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole (CAS 1628110-84-8) is a chemical compound with the molecular formula C13H15Cl2N3 and a molecular weight of 291.22 g/mol. IUPAC name: 1-[3,3,4,4,5,5,5-heptadeuterio-2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole. InChIKey: WKBPZYKAUNRMKP-NCKGIQLSSA-N.
| Molecular formula | C13H15Cl2N3 |
|---|---|
| Molecular weight | 291.22 g/mol |
| IUPAC name | 1-[3,3,4,4,5,5,5-heptadeuterio-2-(2,4-dichlorophenyl)pentyl]-1,2,4-triazole |
| InChIKey | WKBPZYKAUNRMKP-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C(CN1C=NC=N1)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)