CAS 27231-62-5 appears in our catalog under these names: Trans-4'-hydrazino-2-stilbazole Dihydrochloride, 4'-Hydrazino-2-stilbazole dihydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 2,5g, 25mg, 50mg, 100mg, 500mg, 250mg.
[4-[(E)-2-pyridin-2-ylethenyl]phenyl]hydrazine;dihydrochloride (CAS 27231-62-5) is a chemical compound with the molecular formula C13H15Cl2N3 and a molecular weight of 284.18 g/mol. IUPAC name: [4-[(E)-2-pyridin-2-ylethenyl]phenyl]hydrazine;dihydrochloride. InChIKey: BOOKSTAPQSFAJS-RDRKJGRWSA-N.
| Molecular formula | C13H15Cl2N3 |
|---|---|
| Molecular weight | 284.18 g/mol |
| IUPAC name | [4-[(E)-2-pyridin-2-ylethenyl]phenyl]hydrazine;dihydrochloride |
| InChIKey | BOOKSTAPQSFAJS-RDRKJGRWSA-N |
| SMILES | C1=CC=NC(=C1)/C=C/C2=CC=C(C=C2)NN.Cl.Cl |
Computed by PubChem (NCBI)