CAS 1628205-95-7 appears in our catalog under these names: 6-Benzyl 5-tert-butyl (6s)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 95%, 6-Benzyl 5-tert-butyl (6S)-4-oxo-5-azaspiro(2.4)heptane-5,6-dicarboxylate, 97%, 6-Benzyl 5-tert-butyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 97%, 97%, 6-benzyl 5-tert-butyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g, 500mg.
6-O-benzyl 5-O-tert-butyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate (CAS 1628205-95-7) is a chemical compound with the molecular formula C19H23NO5 and a molecular weight of 345.4 g/mol. IUPAC name: 6-O-benzyl 5-O-tert-butyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate. InChIKey: FFXSATUFRAGOJZ-AWEZNQCLSA-N.
| Molecular formula | C19H23NO5 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 6-O-benzyl 5-O-tert-butyl (6S)-4-oxo-5-azaspiro[2.4]heptane-5,6-dicarboxylate |
| InChIKey | FFXSATUFRAGOJZ-AWEZNQCLSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CC2(C1=O)CC2)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)