CAS 220129-58-8 is the registry number for KUL-7211. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenoxy]acetic acid (CAS 220129-58-8) is a chemical compound with the molecular formula C19H23NO5 and a molecular weight of 345.4 g/mol. IUPAC name: 2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenoxy]acetic acid. InChIKey: KKXPBQQLKHBRDA-DJJJIMSYSA-N.
| Molecular formula | C19H23NO5 |
|---|---|
| Molecular weight | 345.4 g/mol |
| IUPAC name | 2-[4-[2-[[(1R,2S)-1-hydroxy-1-(4-hydroxyphenyl)propan-2-yl]amino]ethyl]phenoxy]acetic acid |
| InChIKey | KKXPBQQLKHBRDA-DJJJIMSYSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=C(C=C1)O)O)NCCC2=CC=C(C=C2)OCC(=O)O |
Computed by PubChem (NCBI)