CAS 1628258-89-8 is the registry number for rel-1,1-Dimethylethyl (2R,3S)-2-methyl-3-[[(phenylmethoxy)carbonyl]amino]-1-piperidinecarboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl (2S,3R)-2-methyl-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate (CAS 1628258-89-8) is a chemical compound with the molecular formula C19H28N2O4 and a molecular weight of 348.4 g/mol. IUPAC name: tert-butyl (2S,3R)-2-methyl-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate. InChIKey: CZQDFIFYARZSAX-GOEBONIOSA-N.
| Molecular formula | C19H28N2O4 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | tert-butyl (2S,3R)-2-methyl-3-(phenylmethoxycarbonylamino)piperidine-1-carboxylate |
| InChIKey | CZQDFIFYARZSAX-GOEBONIOSA-N |
| SMILES | C[C@H]1[C@@H](CCCN1C(=O)OC(C)(C)C)NC(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)