CAS 1628264-07-2 appears in our catalog under these names: 6–Bromo–2–ethyl–N,8–dimethylimidazo(1,2–a)pyridin–3–amine, 6-bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine, 95%, 95%, 6-Bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
6-bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine (CAS 1628264-07-2) is a chemical compound with the molecular formula C11H14BrN3 and a molecular weight of 268.15 g/mol. IUPAC name: 6-bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine. InChIKey: UJVUQAQBHSQIIB-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3 |
|---|---|
| Molecular weight | 268.15 g/mol |
| IUPAC name | 6-bromo-2-ethyl-N,8-dimethylimidazo[1,2-a]pyridin-3-amine |
| InChIKey | UJVUQAQBHSQIIB-UHFFFAOYSA-N |
| SMILES | CCC1=C(N2C=C(C=C(C2=N1)C)Br)NC |
Computed by PubChem (NCBI)