Products 281204-64-6
CAS 281204-64-6 is the registry number for 6-BROMO-N,N-DIMETHYL-1H-INDAZOLE-1-ETHANAMINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2-(6-bromoindazol-1-yl)-N,N-dimethylethanamine (CAS 281204-64-6) is a chemical compound with the molecular formula C11H14BrN3 and a molecular weight of 268.15 g/mol. IUPAC name: 2-(6-bromoindazol-1-yl)-N,N-dimethylethanamine. InChIKey: JMRSKQYXYMGSDI-UHFFFAOYSA-N.
| Molecular formula | C11H14BrN3 |
|---|---|
| Molecular weight | 268.15 g/mol |
| IUPAC name | 2-(6-bromoindazol-1-yl)-N,N-dimethylethanamine |
| InChIKey | JMRSKQYXYMGSDI-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C2=C(C=CC(=C2)Br)C=N1 |
Computed by PubChem (NCBI)