Products 1628501-79-0
CAS 1628501-79-0 is the registry number for tert-butyl (S)-4-bromo-3-methyl-3,6-dihydropyridine-1(2H)-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (3S)-4-bromo-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate (CAS 1628501-79-0) is a chemical compound with the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. IUPAC name: tert-butyl (3S)-4-bromo-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate. InChIKey: KUMKNIOTZLICLP-QMMMGPOBSA-N.
| Molecular formula | C11H18BrNO2 |
|---|---|
| Molecular weight | 276.17 g/mol |
| IUPAC name | tert-butyl (3S)-4-bromo-3-methyl-3,6-dihydro-2H-pyridine-1-carboxylate |
| InChIKey | KUMKNIOTZLICLP-QMMMGPOBSA-N |
| SMILES | C[C@H]1CN(CC=C1Br)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)