Products 2126159-83-7

CAS 2126159-83-7 is the registry number for tert-Butyl 6-bromo-2,3,4,5-tetrahydro-1H-azepine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl 6-bromo-2,3,4,5-tetrahydroazepine-1-carboxylate (CAS 2126159-83-7) is a chemical compound with the molecular formula C11H18BrNO2 and a molecular weight of 276.17 g/mol. IUPAC name: tert-butyl 6-bromo-2,3,4,5-tetrahydroazepine-1-carboxylate. InChIKey: WXBGEQNCPITVRE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18BrNO2
Molecular weight276.17 g/mol
IUPAC nametert-butyl 6-bromo-2,3,4,5-tetrahydroazepine-1-carboxylate
InChIKeyWXBGEQNCPITVRE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCCC(=C1)Br

Computed by PubChem (NCBI)