Products 1628607-62-4
CAS 1628607-62-4 appears in our catalog under these names: INCB054329 Racemate, 99+%, INCB054329 Racemate, INCB054329 (Racemate), 96.69%. Offered by: AmBeed, GLPBio, MedChemExpress. Available pack sizes: 250mg, 1g, 10mg, 25mg, 5mg, 50mg, Get quote.
7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one (CAS 1628607-62-4) is a chemical compound with the molecular formula C19H16N4O3 and a molecular weight of 348.4 g/mol. IUPAC name: 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one. InChIKey: XYLPKCDRAAYATL-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 7-(3,5-dimethyl-1,2-oxazol-4-yl)-11-pyridin-2-yl-9-oxa-1,3-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7-trien-2-one |
| InChIKey | XYLPKCDRAAYATL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C)C2=C3C4=C(C=C2)NC(=O)N4C(CO3)C5=CC=CC=N5 |
Computed by PubChem (NCBI)