CAS 2285346-38-3 appears in our catalog under these names: Ilaprazole Impurity 34, Ilaprazole Impurity 21, 1-(6-(1H-pyrrol-1-yl)-1H-benzo(d)imidazol-2-yl)-4-methoxy-3-methylpyridin-1-ium-2-carboxylate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-carboxylate (CAS 2285346-38-3) is a chemical compound with the molecular formula C19H16N4O3 and a molecular weight of 348.4 g/mol. IUPAC name: 4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-carboxylate. InChIKey: LTOVHIDQQVDTHZ-UHFFFAOYSA-N.
| Molecular formula | C19H16N4O3 |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | 4-methoxy-3-methyl-1-(6-pyrrol-1-yl-1H-benzimidazol-2-yl)pyridin-1-ium-2-carboxylate |
| InChIKey | LTOVHIDQQVDTHZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C[N+](=C1C(=O)[O-])C2=NC3=C(N2)C=C(C=C3)N4C=CC=C4)OC |
Computed by PubChem (NCBI)