CAS 1628946-67-7 is the registry number for 6-bromo-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylic acid,sodium salt, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
CAS 1628946-67-7 identifies a chemical compound with the molecular formula C7H4BrN3NaO2 and a molecular weight of 265.02 g/mol. InChIKey: BNXHLBXGFGLSFD-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3NaO2 |
|---|---|
| Molecular weight | 265.02 g/mol |
| InChIKey | BNXHLBXGFGLSFD-UHFFFAOYSA-N |
| SMILES | C1=CC2=NN=C(N2C=C1Br)C(=O)O.[Na] |
Computed by PubChem (NCBI)