CAS 2940956-27-2 appears in our catalog under these names: 7-bromo-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylic acid sodium salt, 95%, 7-bromo-[1,2,4]triazolo[4,3-a]pyridine-3-carboxylic acid sodium salt, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
CAS 2940956-27-2 identifies a chemical compound with the molecular formula C7H4BrN3NaO2 and a molecular weight of 265.02 g/mol. InChIKey: DDMZVYFTHOSIGY-UHFFFAOYSA-N.
| Molecular formula | C7H4BrN3NaO2 |
|---|---|
| Molecular weight | 265.02 g/mol |
| InChIKey | DDMZVYFTHOSIGY-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NN=C2C(=O)O)C=C1Br.[Na] |
Computed by PubChem (NCBI)