CAS 1628950-02-6 is the registry number for 1–(4–methoxybenzyl)–1H–thieno(2,3–d)(1,3)oxazine–2,4–dione. Offered by: GLPBio. Available pack sizes: 1g.
1-[(4-methoxyphenyl)methyl]thieno[2,3-d][1,3]oxazine-2,4-dione (CAS 1628950-02-6) is a chemical compound with the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. IUPAC name: 1-[(4-methoxyphenyl)methyl]thieno[2,3-d][1,3]oxazine-2,4-dione. InChIKey: UTVFVQSOWWTMCW-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 1-[(4-methoxyphenyl)methyl]thieno[2,3-d][1,3]oxazine-2,4-dione |
| InChIKey | UTVFVQSOWWTMCW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C3=C(C=CS3)C(=O)OC2=O |
Computed by PubChem (NCBI)