CAS 1858241-32-3 appears in our catalog under these names: 6-Methyl-6h-dibenzo[c,e][1,2]thiazine-9-carboxylic acid 5,5-dioxide, 95%, 6-MEthyl-6h-dibenzo(c,e)(1,2)thiazine-9-carboxylic acid 5,5-dioxide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g.
6-methyl-5,5-dioxobenzo[c][1,2]benzothiazine-9-carboxylic acid (CAS 1858241-32-3) is a chemical compound with the molecular formula C14H11NO4S and a molecular weight of 289.31 g/mol. IUPAC name: 6-methyl-5,5-dioxobenzo[c][1,2]benzothiazine-9-carboxylic acid. InChIKey: OCQOTMGZPKWLNU-UHFFFAOYSA-N.
| Molecular formula | C14H11NO4S |
|---|---|
| Molecular weight | 289.31 g/mol |
| IUPAC name | 6-methyl-5,5-dioxobenzo[c][1,2]benzothiazine-9-carboxylic acid |
| InChIKey | OCQOTMGZPKWLNU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)C(=O)O)C3=CC=CC=C3S1(=O)=O |
Computed by PubChem (NCBI)