CAS 1629052-58-9 appears in our catalog under these names: (E)-3-(4-(((Adamantan-1-ylmethyl)(methyl)amino)methyl)phenyl)-N-hydroxyacrylamide, 97%, Martinostat. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 5mg, 50mg, 5 mg, 50 mg, 25 mg.
(E)-3-[4-[[1-adamantylmethyl(methyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide (CAS 1629052-58-9) is a chemical compound with the molecular formula C22H30N2O2 and a molecular weight of 354.5 g/mol. IUPAC name: (E)-3-[4-[[1-adamantylmethyl(methyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide. InChIKey: WNIDBXBLQFPAJA-VOTSOKGWSA-N.
| Molecular formula | C22H30N2O2 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | (E)-3-[4-[[1-adamantylmethyl(methyl)amino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| InChIKey | WNIDBXBLQFPAJA-VOTSOKGWSA-N |
| SMILES | CN(CC1=CC=C(C=C1)/C=C/C(=O)NO)CC23CC4CC(C2)CC(C4)C3 |
Computed by PubChem (NCBI)