Products 907609-33-0
CAS 907609-33-0 is the registry number for TAK-100. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[5-(aminomethyl)-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-3-pyridinyl]acetic acid (CAS 907609-33-0) is a chemical compound with the molecular formula C22H30N2O2 and a molecular weight of 354.5 g/mol. IUPAC name: 2-[5-(aminomethyl)-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-3-pyridinyl]acetic acid. InChIKey: HQVOROHHYWZJLD-UHFFFAOYSA-N.
| Molecular formula | C22H30N2O2 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | 2-[5-(aminomethyl)-6-(2,2-dimethylpropyl)-2-ethyl-4-(4-methylphenyl)-3-pyridinyl]acetic acid |
| InChIKey | HQVOROHHYWZJLD-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=C(C(=N1)CC(C)(C)C)CN)C2=CC=C(C=C2)C)CC(=O)O |
Computed by PubChem (NCBI)