CAS 1629270-62-7 is the registry number for 2-Amino-4-bromo-5-chlorobenzamide, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-amino-4-bromo-5-chlorobenzamide (CAS 1629270-62-7) is a chemical compound with the molecular formula C7H6BrClN2O and a molecular weight of 249.49 g/mol. IUPAC name: 2-amino-4-bromo-5-chlorobenzamide. InChIKey: NHTJQTYNHIWXNH-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2O |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 2-amino-4-bromo-5-chlorobenzamide |
| InChIKey | NHTJQTYNHIWXNH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Br)N)C(=O)N |
Computed by PubChem (NCBI)