CAS 1820674-67-6 is the registry number for 5-bromo-1,3-benzoxazol-2-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-1,3-benzoxazol-2-amine;hydrochloride (CAS 1820674-67-6) is a chemical compound with the molecular formula C7H6BrClN2O and a molecular weight of 249.49 g/mol. IUPAC name: 5-bromo-1,3-benzoxazol-2-amine;hydrochloride. InChIKey: VUBMEOPJYRVAOB-UHFFFAOYSA-N.
| Molecular formula | C7H6BrClN2O |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 5-bromo-1,3-benzoxazol-2-amine;hydrochloride |
| InChIKey | VUBMEOPJYRVAOB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)N=C(O2)N.Cl |
Computed by PubChem (NCBI)