CAS 16293-12-2 is the registry number for N1,N1–Dimethyl–3–nitrobenzene–1,4–diamine. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine (CAS 16293-12-2) is a chemical compound with the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. IUPAC name: 4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine. InChIKey: COWGRITUYIECBW-UHFFFAOYSA-N.
| Molecular formula | C8H11N3O2 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 4-N,4-N-dimethyl-2-nitrobenzene-1,4-diamine |
| InChIKey | COWGRITUYIECBW-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)