Products 162935-29-7
CAS 162935-29-7 appears in our catalog under these names: Propyphenazone-d3 (2-N-methyl-d3), >95% (HPLC), Propyphenazone-d3 (2-N-methyl-d3), 99 atom % D, min 98% Chemical Purity, Propyphenazone–d3, Propyphenazone-d3, 99.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
5-methyl-2-phenyl-4-propan-2-yl-1-(trideuteriomethyl)pyrazol-3-one (CAS 162935-29-7) is a chemical compound with the molecular formula C14H18N2O and a molecular weight of 233.32 g/mol. IUPAC name: 5-methyl-2-phenyl-4-propan-2-yl-1-(trideuteriomethyl)pyrazol-3-one. InChIKey: PXWLVJLKJGVOKE-GKOSEXJESA-N.
| Molecular formula | C14H18N2O |
|---|---|
| Molecular weight | 233.32 g/mol |
| IUPAC name | 5-methyl-2-phenyl-4-propan-2-yl-1-(trideuteriomethyl)pyrazol-3-one |
| InChIKey | PXWLVJLKJGVOKE-GKOSEXJESA-N |
| SMILES | [2H]C([2H])([2H])N1C(=C(C(=O)N1C2=CC=CC=C2)C(C)C)C |
Computed by PubChem (NCBI)