CAS 1629658-27-0 appears in our catalog under these names: Fmoc-L-Phe(3-F,4-Cl)-OH, Fmoc-Phe(3-F,4-Cl)-OH 95%. Offered by: Iris Biotech, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g.
(2S)-3-(4-chloro-3-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1629658-27-0) is a chemical compound with the molecular formula C24H19ClFNO4 and a molecular weight of 439.9 g/mol. IUPAC name: (2S)-3-(4-chloro-3-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: ABNJHASPCQWVPF-QFIPXVFZSA-N.
| Molecular formula | C24H19ClFNO4 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | (2S)-3-(4-chloro-3-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | ABNJHASPCQWVPF-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC(=C(C=C4)Cl)F)C(=O)O |
Computed by PubChem (NCBI)