CAS 1998676-43-9 is the registry number for (S)-2-((((9H- fluoren-9-yl) methoxy)carbonyl) amino)-3-(5- chloro-2- fluorophenyl) propanoic acid, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
(2S)-3-(5-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid (CAS 1998676-43-9) is a chemical compound with the molecular formula C24H19ClFNO4 and a molecular weight of 439.9 g/mol. IUPAC name: (2S)-3-(5-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid. InChIKey: MHWWPLIFDBSYNY-QFIPXVFZSA-N.
| Molecular formula | C24H19ClFNO4 |
|---|---|
| Molecular weight | 439.9 g/mol |
| IUPAC name | (2S)-3-(5-chloro-2-fluorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
| InChIKey | MHWWPLIFDBSYNY-QFIPXVFZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=C(C=CC(=C4)Cl)F)C(=O)O |
Computed by PubChem (NCBI)