Products 1629722-47-9
CAS 1629722-47-9 is the registry number for L-Tryptophan, 1-[2-(1,1-dimethylethoxy)-2-oxoethyl]-, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
(2S)-2-amino-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid (CAS 1629722-47-9) is a chemical compound with the molecular formula C17H22N2O4 and a molecular weight of 318.4 g/mol. IUPAC name: (2S)-2-amino-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid. InChIKey: NEWFZNOWZPCXFK-ZDUSSCGKSA-N.
| Molecular formula | C17H22N2O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | (2S)-2-amino-3-[1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-3-yl]propanoic acid |
| InChIKey | NEWFZNOWZPCXFK-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)CN1C=C(C2=CC=CC=C21)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)