CAS 1630101-52-8 appears in our catalog under these names: trans-4-(aminomethyl)-1-methyl-cyclohexanol,4-methylbenzenesulfonic acid, 98%, 98%, (1R,4R)-4-(Aminomethyl)-1-methylcyclohexan-1-ol 4-methylbenzenesulfonate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g.
4-(aminomethyl)-1-methylcyclohexan-1-ol;4-methylbenzenesulfonic acid (CAS 1630101-52-8) is a chemical compound with the molecular formula C15H25NO4S and a molecular weight of 315.4 g/mol. IUPAC name: 4-(aminomethyl)-1-methylcyclohexan-1-ol;4-methylbenzenesulfonic acid. InChIKey: AEIHBQUSRNHJJC-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | 4-(aminomethyl)-1-methylcyclohexan-1-ol;4-methylbenzenesulfonic acid |
| InChIKey | AEIHBQUSRNHJJC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC1(CCC(CC1)CN)O |
Computed by PubChem (NCBI)