CAS 240125-70-6 appears in our catalog under these names: 1-[(11-sulfanylundecanoyl)oxy]-2,5-pyrrolidinedione, 95%, 2,5-Dioxopyrrolidin-1-yl 11-mercaptoundecanoate, 95%, 11-Mercaptoundecanoic acid 2,5-dioxo-1-pyrrolidinyl ester, 1-[(11-sulfanylundecanoyl)oxy]-2,5-pyrrolidinedione, 98%, 98%, 11-Mercaptoundecanoate-NHS, 98.0%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5g, 250mg, 1g, 100mg, 50mg, 500mg, 1000mg, 50 mg.
(2,5-dioxopyrrolidin-1-yl) 11-sulfanylundecanoate (CAS 240125-70-6) is a chemical compound with the molecular formula C15H25NO4S and a molecular weight of 315.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 11-sulfanylundecanoate. InChIKey: JPXQEYQKZFROQX-UHFFFAOYSA-N.
| Molecular formula | C15H25NO4S |
|---|---|
| Molecular weight | 315.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 11-sulfanylundecanoate |
| InChIKey | JPXQEYQKZFROQX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCCCCCCCS |
Computed by PubChem (NCBI)