CAS 1630101-81-3 is the registry number for Butyl 2-((1H-pyrrolo[2,3-b]pyridin-5-yl)oxy)-4-bromobenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Butyl 4-bromo-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (CAS 1630101-81-3) is a chemical compound with the molecular formula C18H17BrN2O3 and a molecular weight of 389.2 g/mol. IUPAC name: butyl 4-bromo-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate. InChIKey: RPHPGDUGUJEESK-UHFFFAOYSA-N.
| Molecular formula | C18H17BrN2O3 |
|---|---|
| Molecular weight | 389.2 g/mol |
| IUPAC name | butyl 4-bromo-2-(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
| InChIKey | RPHPGDUGUJEESK-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)C1=C(C=C(C=C1)Br)OC2=CN=C3C(=C2)C=CN3 |
Computed by PubChem (NCBI)