Products 182344-68-9

CAS 182344-68-9 is the registry number for N-(2-Morpholinoethyl)-4-bromo-1,8-naphthalimide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

6-bromo-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione (CAS 182344-68-9) is a chemical compound with the molecular formula C18H17BrN2O3 and a molecular weight of 389.2 g/mol. IUPAC name: 6-bromo-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione. InChIKey: DZIHEJLGSDCGCL-UHFFFAOYSA-N.

Identity
Molecular formulaC18H17BrN2O3
Molecular weight389.2 g/mol
IUPAC name6-bromo-2-(2-morpholin-4-ylethyl)benzo[de]isoquinoline-1,3-dione
InChIKeyDZIHEJLGSDCGCL-UHFFFAOYSA-N
SMILESC1COCCN1CCN2C(=O)C3=C4C(=C(C=C3)Br)C=CC=C4C2=O

Computed by PubChem (NCBI)