Products 163011-56-1

CAS 163011-56-1 is the registry number for 4-(1,2,4-Oxadiazol-3-yl)-1,2,5-oxadiazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 50g, 5g, 1g.

Structural formula: {0} (CAS {1})

4-(1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-amine (CAS 163011-56-1) is a chemical compound with the molecular formula C4H3N5O2 and a molecular weight of 153.10 g/mol. IUPAC name: 4-(1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-amine. InChIKey: XHCUQOVMSNRPKS-UHFFFAOYSA-N.

Identity
Molecular formulaC4H3N5O2
Molecular weight153.10 g/mol
IUPAC name4-(1,2,4-oxadiazol-3-yl)-1,2,5-oxadiazol-3-amine
InChIKeyXHCUQOVMSNRPKS-UHFFFAOYSA-N
SMILESC1=NC(=NO1)C2=NON=C2N

Computed by PubChem (NCBI)