CAS 2732488-77-4 is the registry number for 2-Aza-8-oxo-hypoxanthine-13C3. Offered by: TRC. Available pack sizes: 25mg.
5,7-dihydro-3H-(4,5-13C2)imidazolo[4,5-d](4,5,6-13C3)triazine-4,6-dione (CAS 2732488-77-4) is a chemical compound with the molecular formula C4H3N5O2 and a molecular weight of 156.08 g/mol. IUPAC name: 5,7-dihydro-3H-(4,5-13C2)imidazolo[4,5-d](4,5,6-13C3)triazine-4,6-dione. InChIKey: SGERKLTVOIUKSN-VMIGTVKRSA-N.
| Molecular formula | C4H3N5O2 |
|---|---|
| Molecular weight | 156.08 g/mol |
| IUPAC name | 5,7-dihydro-3H-(4,5-13C2)imidazolo[4,5-d](4,5,6-13C3)triazine-4,6-dione |
| InChIKey | SGERKLTVOIUKSN-VMIGTVKRSA-N |
| SMILES | C1(=O)N[13C]2=[13C](N1)N=NN[13C]2=O |
Computed by PubChem (NCBI)