Products 1630746-27-8
CAS 1630746-27-8 is the registry number for Cholesterol 24-hydroxylase-IN-3, 98.74%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 10 mg, 5 mg.
N-[6-(1,3-oxazol-5-yl)-4-(trifluoromethyl)-2-pyridinyl]cyclopropanecarboxamide (CAS 1630746-27-8) is a chemical compound with the molecular formula C13H10F3N3O2 and a molecular weight of 297.23 g/mol. IUPAC name: N-[6-(1,3-oxazol-5-yl)-4-(trifluoromethyl)-2-pyridinyl]cyclopropanecarboxamide. InChIKey: ZFIYGIJALJMZIZ-UHFFFAOYSA-N.
| Molecular formula | C13H10F3N3O2 |
|---|---|
| Molecular weight | 297.23 g/mol |
| IUPAC name | N-[6-(1,3-oxazol-5-yl)-4-(trifluoromethyl)-2-pyridinyl]cyclopropanecarboxamide |
| InChIKey | ZFIYGIJALJMZIZ-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)NC2=CC(=CC(=N2)C3=CN=CO3)C(F)(F)F |
Computed by PubChem (NCBI)