CAS 1630815-54-1 appears in our catalog under these names: Methyl 5-[(1S)-1-amino-2-hydroxyethyl]-2-chlorobenzoate hydrochloride, 96%, (S)-Methyl 5-(1-amino-2-hydroxyethyl)-2-chlorobenzoate hydrochloride, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl 5-[(1S)-1-amino-2-hydroxyethyl]-2-chlorobenzoate;hydrochloride (CAS 1630815-54-1) is a chemical compound with the molecular formula C10H13Cl2NO3 and a molecular weight of 266.12 g/mol. IUPAC name: methyl 5-[(1S)-1-amino-2-hydroxyethyl]-2-chlorobenzoate;hydrochloride. InChIKey: FZAOTWPXCMVXJN-SBSPUUFOSA-N.
| Molecular formula | C10H13Cl2NO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | methyl 5-[(1S)-1-amino-2-hydroxyethyl]-2-chlorobenzoate;hydrochloride |
| InChIKey | FZAOTWPXCMVXJN-SBSPUUFOSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)[C@@H](CO)N)Cl.Cl |
Computed by PubChem (NCBI)