CAS 2061996-84-5 appears in our catalog under these names: (S)-3-Amino-3-(3-chloro-5-methoxyphenyl)propanoic acid hydrochloride, 95%, (S)-3-Amino-3-(3-chloro-5-methoxyphenyl)propanoic acid hydrochloride, 97%, (S)–3–amino–3–(3–chloro–5–methoxyphenyl)propanoic acid hydrochloride, (S)-3-amino-3-(3-chloro-5-methoxyphenyl)propanoic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(3S)-3-amino-3-(3-chloro-5-methoxyphenyl)propanoic acid;hydrochloride (CAS 2061996-84-5) is a chemical compound with the molecular formula C10H13Cl2NO3 and a molecular weight of 266.12 g/mol. IUPAC name: (3S)-3-amino-3-(3-chloro-5-methoxyphenyl)propanoic acid;hydrochloride. InChIKey: UNSVDYBHADSVOU-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO3 |
|---|---|
| Molecular weight | 266.12 g/mol |
| IUPAC name | (3S)-3-amino-3-(3-chloro-5-methoxyphenyl)propanoic acid;hydrochloride |
| InChIKey | UNSVDYBHADSVOU-FVGYRXGTSA-N |
| SMILES | COC1=CC(=CC(=C1)[C@H](CC(=O)O)N)Cl.Cl |
Computed by PubChem (NCBI)