CAS 1630905-41-7 is the registry number for 2-Acetyl-4-bromo-5-methylisoxazol-3(2h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-acetyl-4-bromo-5-methyl-1,2-oxazol-3-one (CAS 1630905-41-7) is a chemical compound with the molecular formula C6H6BrNO3 and a molecular weight of 220.02 g/mol. IUPAC name: 2-acetyl-4-bromo-5-methyl-1,2-oxazol-3-one. InChIKey: ANGLGOLSOHTXRV-UHFFFAOYSA-N.
| Molecular formula | C6H6BrNO3 |
|---|---|
| Molecular weight | 220.02 g/mol |
| IUPAC name | 2-acetyl-4-bromo-5-methyl-1,2-oxazol-3-one |
| InChIKey | ANGLGOLSOHTXRV-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(O1)C(=O)C)Br |
Computed by PubChem (NCBI)