Products 1784886-95-8

CAS 1784886-95-8 is the registry number for 5-Bromo-3-ethylisoxazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-bromo-3-ethyl-1,2-oxazole-4-carboxylic acid (CAS 1784886-95-8) is a chemical compound with the molecular formula C6H6BrNO3 and a molecular weight of 220.02 g/mol. IUPAC name: 5-bromo-3-ethyl-1,2-oxazole-4-carboxylic acid. InChIKey: YRGRWODYKFLFIG-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6BrNO3
Molecular weight220.02 g/mol
IUPAC name5-bromo-3-ethyl-1,2-oxazole-4-carboxylic acid
InChIKeyYRGRWODYKFLFIG-UHFFFAOYSA-N
SMILESCCC1=NOC(=C1C(=O)O)Br

Computed by PubChem (NCBI)