CAS 1631-29-4 appears in our catalog under these names: N-(4-Chlorophenyl)maleimide, 97%, 97%, 1-(4-Chlorophenyl)-1h-pyrrole-2,5-dione, 95%, 1-(4-Chlorophenyl)-1H-pyrrole-2,5-dione, 97%, 1-(4-Chloro-phenyl)-pyrrole-2,5-dione, 95%. Offered by: Chemat, Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 2.5g.
1-(4-chlorophenyl)pyrrole-2,5-dione (CAS 1631-29-4) is a chemical compound with the molecular formula C10H6ClNO2 and a molecular weight of 207.61 g/mol. IUPAC name: 1-(4-chlorophenyl)pyrrole-2,5-dione. InChIKey: FPZQYYXSOJSITC-UHFFFAOYSA-N.
| Molecular formula | C10H6ClNO2 |
|---|---|
| Molecular weight | 207.61 g/mol |
| IUPAC name | 1-(4-chlorophenyl)pyrrole-2,5-dione |
| InChIKey | FPZQYYXSOJSITC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)C=CC2=O)Cl |
Computed by PubChem (NCBI)