CAS 1632497-68-7 is the registry number for 4-(4-Bromo-2-fluorophenyl)-1-isobutyl-1h-1,2,4-triazol-5(4h)-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
4-(4-bromo-2-fluorophenyl)-2-(2-methylpropyl)-1,2,4-triazol-3-one (CAS 1632497-68-7) is a chemical compound with the molecular formula C12H13BrFN3O and a molecular weight of 314.15 g/mol. IUPAC name: 4-(4-bromo-2-fluorophenyl)-2-(2-methylpropyl)-1,2,4-triazol-3-one. InChIKey: VGUFBEQGUUJSNJ-UHFFFAOYSA-N.
| Molecular formula | C12H13BrFN3O |
|---|---|
| Molecular weight | 314.15 g/mol |
| IUPAC name | 4-(4-bromo-2-fluorophenyl)-2-(2-methylpropyl)-1,2,4-triazol-3-one |
| InChIKey | VGUFBEQGUUJSNJ-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C(=O)N(C=N1)C2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)