Products 2555019-59-3
CAS 2555019-59-3 is the registry number for 6-Bromo-3-fluoro-1-(tetrahydro-2H-pyran-2-yl)-1H-indazol-5-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg.
6-bromo-3-fluoro-1-(oxan-2-yl)indazol-5-amine (CAS 2555019-59-3) is a chemical compound with the molecular formula C12H13BrFN3O and a molecular weight of 314.15 g/mol. IUPAC name: 6-bromo-3-fluoro-1-(oxan-2-yl)indazol-5-amine. InChIKey: OYMKCDCKIHFCMP-UHFFFAOYSA-N.
| Molecular formula | C12H13BrFN3O |
|---|---|
| Molecular weight | 314.15 g/mol |
| IUPAC name | 6-bromo-3-fluoro-1-(oxan-2-yl)indazol-5-amine |
| InChIKey | OYMKCDCKIHFCMP-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C3=CC(=C(C=C3C(=N2)F)N)Br |
Computed by PubChem (NCBI)