CAS 16344-24-4 appears in our catalog under these names: 2-Anilinonicotinic acid, 95%, 2-(Phenylamino)nicotinic Acid, >95% (HPLC), 2-(Phenylamino)nicotinic acid 95+%, 2-(Phenylamino)nicotinic acid, 95+%, 95+%, 2-(Phenylamino)nicotinic acid, 98%. Offered by: Combi-blocks, TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10mg, 50mg, 5mg, 100mg.
2-anilinopyridine-3-carboxylic acid (CAS 16344-24-4) is a chemical compound with the molecular formula C12H10N2O2 and a molecular weight of 214.22 g/mol. IUPAC name: 2-anilinopyridine-3-carboxylic acid. InChIKey: UUMMTMQODCACRH-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O2 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | 2-anilinopyridine-3-carboxylic acid |
| InChIKey | UUMMTMQODCACRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)