Products 163521-11-7

CAS 163521-11-7 is the registry number for Vilazodone Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate (CAS 163521-11-7) is a chemical compound with the molecular formula C28H30N4O3 and a molecular weight of 470.6 g/mol. IUPAC name: ethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate. InChIKey: NEAYFBXORWZSFT-UHFFFAOYSA-N.

Identity
Molecular formulaC28H30N4O3
Molecular weight470.6 g/mol
IUPAC nameethyl 5-[4-[4-(5-cyano-1H-indol-3-yl)butyl]piperazin-1-yl]-1-benzofuran-2-carboxylate
InChIKeyNEAYFBXORWZSFT-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(O1)C=CC(=C2)N3CCN(CC3)CCCCC4=CNC5=C4C=C(C=C5)C#N

Computed by PubChem (NCBI)