Products 191102-87-1
CAS 191102-87-1 appears in our catalog under these names: GGTI-2147, GGTI 2147/ 99.32% (existing batch purity), GGTI-2147 1PC X 250UG, GGTI 2147, 98.69% ,, 98.69% ,. Offered by: TRC, TargetMol, Sigma-Aldrich, Chemat, MedChemExpress. Available pack sizes: 50mg, 1mg, 5mg, 10mg, 25mg, 100mg, 250UG, 5 mg.
Methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoate (CAS 191102-87-1) is a chemical compound with the molecular formula C28H30N4O3 and a molecular weight of 470.6 g/mol. IUPAC name: methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoate. InChIKey: TUQRZGWNDBXSNP-SANMLTNESA-N.
| Molecular formula | C28H30N4O3 |
|---|---|
| Molecular weight | 470.6 g/mol |
| IUPAC name | methyl (2S)-2-[[4-(1H-imidazol-5-ylmethylamino)-2-naphthalen-1-ylbenzoyl]amino]-4-methylpentanoate |
| InChIKey | TUQRZGWNDBXSNP-SANMLTNESA-N |
| SMILES | CC(C)C[C@@H](C(=O)OC)NC(=O)C1=C(C=C(C=C1)NCC2=CN=CN2)C3=CC=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)