Products 163634-08-0
CAS 163634-08-0 appears in our catalog under these names: (S)–(+)–Imperanene, (S)-(+)-Imperanene. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5 mg, 1 mg.
4-[(E,2S)-4-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)but-3-enyl]-2-methoxyphenol (CAS 163634-08-0) is a chemical compound with the molecular formula C19H22O5 and a molecular weight of 330.4 g/mol. IUPAC name: 4-[(E,2S)-4-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)but-3-enyl]-2-methoxyphenol. InChIKey: RCQPYMXHGRTMOZ-NHZBNJEXSA-N.
| Molecular formula | C19H22O5 |
|---|---|
| Molecular weight | 330.4 g/mol |
| IUPAC name | 4-[(E,2S)-4-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)but-3-enyl]-2-methoxyphenol |
| InChIKey | RCQPYMXHGRTMOZ-NHZBNJEXSA-N |
| SMILES | COC1=C(C=CC(=C1)C[C@H](CO)/C=C/C2=CC(=C(C=C2)O)OC)O |
Computed by PubChem (NCBI)